Products 122839-59-2
CAS 122839-59-2 appears in our catalog under these names: 4-Bromo-l-phe-oh hydrochloride, 95%, (S)–2–Amino–3–(4–bromophenyl)propanoic acid hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 500g.
(2S)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride (CAS 122839-59-2) is a chemical compound with the molecular formula C9H11BrClNO2 and a molecular weight of 280.54 g/mol. IUPAC name: (2S)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride. InChIKey: GRWMPXZZFAPLFZ-QRPNPIFTSA-N.
| Molecular formula | C9H11BrClNO2 |
|---|---|
| Molecular weight | 280.54 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride |
| InChIKey | GRWMPXZZFAPLFZ-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)Br.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-bromophenylalanine hydrochloride, (S)-2-amino-3-(4-bromophenyl)propanoic acid hydrochloride, 4-Bromo-L-Phe-OH HCl, 4-Bromophenylalanine Hydrochloride Salt, (2S)-2-amino-3-(4-bromophenyl)propanoic acid;hydrochloride, 4-Bromo-L-Phenylalanine HCl, 4-Bromo-l-phe-oh hydrochloride, p-bromo-l-phenylalanine hydrochloride