cas: 326-58-9 — see every product listed under this CAS number, including other names
Benzo[d][1,3]dioxol-5-yl acetate (CAS 326-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545093-250MG |
| cas | 326-58-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 1237.08 Pln |
| delivery time | 3-4 weeks |
|---|
1,3-benzodioxol-5-yl acetate (CAS 326-58-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 1,3-benzodioxol-5-yl acetate. InChIKey: QNJMUNKUQDDPCI-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl acetate |
| InChIKey | QNJMUNKUQDDPCI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)