CAS 326-58-9 appears in our catalog under these names: Benzo[d][1,3]dioxol-5-yl acetate, 95%, Benzo(d)(1,3)dioxol–5–yl acetate, Sesamol acetate, Benzo[d][1,3]dioxol-5-yl acetate, 97%, 97%, Benzo[d][1,3]dioxol-5-yl acetate. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g, 100mg, 50g, 250g, 250mg.
1,3-benzodioxol-5-yl acetate (CAS 326-58-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 1,3-benzodioxol-5-yl acetate. InChIKey: QNJMUNKUQDDPCI-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1,3-benzodioxol-5-yl acetate |
| InChIKey | QNJMUNKUQDDPCI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)