cas: 65685-01-0 — see every product listed under this CAS number, including other names
Biphenyl-3-sulfonyl chloride, 98% (CAS 65685-01-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014900-250MG |
| cas | 65685-01-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 2340.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-phenylbenzenesulfonyl chloride (CAS 65685-01-0) is a chemical compound with the molecular formula C12H9ClO2S and a molecular weight of 252.72 g/mol. IUPAC name: 3-phenylbenzenesulfonyl chloride. InChIKey: LKSVJXWZVULUDA-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO2S |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 3-phenylbenzenesulfonyl chloride |
| InChIKey | LKSVJXWZVULUDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)