Boc-D-3-Abu-OH 95%
cas: 159991-23-8 — see every product listed under this CAS number, including other names
Boc-D-3-Abu-OH 95% (CAS 159991-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A136124-1g |
| cas | 159991-23-8 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 242.44 Pln | |
| Ambeed | 500g | 854.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A136124 |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 159991-23-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PYNDHEONPQYIAN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PYNDHEONPQYIAN-ZCFIWIBFSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
(R)-3-((tert-Butoxycarbonyl)amino)butanoic acid, (3R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]butanoic acid, (3R)-3-(((1,1-Dimethylethoxy)carbonyl)amino)butanoic acid, Boc-D-3-Abu-OH, (R)-N-Boc-3-aminobutyric acid, boc-d-beta-homoalanine, (R)-3-tert-Butoxycarbonylamino-butyric acid, Butanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-, (3R)-, (3R)-3-(tert-butoxycarbonylamino)butanoic acid, (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid