cas: 159991-23-8 — see every product listed under this CAS number, including other names
Boc-D-3-Abu-OH, 98%, 98% (CAS 159991-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RKV-1g |
| cas | 159991-23-8 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 50g | 98.00 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 500g | 489.60 Pln | |
| Chemat | 250g | 246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 159991-23-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PYNDHEONPQYIAN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PYNDHEONPQYIAN-ZCFIWIBFSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)