cas: 159991-23-8 — see every product listed under this CAS number, including other names
Boc-D-3-Abu-OH, 95% (CAS 159991-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552114-1G |
| cas | 159991-23-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 100g | 227.02 Pln | |
| Fluorochem | 500g | 924.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 159991-23-8) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: PYNDHEONPQYIAN-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | PYNDHEONPQYIAN-ZCFIWIBFSA-N |
| SMILES | C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)