cas: 124184-67-4 — see every product listed under this CAS number, including other names
Boc-D-Asp(OMe)-OH, 95% (CAS 124184-67-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A124190-250mg |
| cas | 124184-67-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 665.19 Pln | |
| Ambeed | 500g | 2167.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 124184-67-4) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: WFPSMPYVXFVVFA-ZCFIWIBFSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | WFPSMPYVXFVVFA-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)