cas: 124184-67-4 — see every product listed under this CAS number, including other names
D-Aspartic acid,N-[(1,1-dimethylethoxy)carbonyl]-, 4-methyl ester, 98%, 98% (CAS 124184-67-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111LN4-250mg |
| cas | 124184-67-4 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 50g | 270.80 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 250g | 990.80 Pln | |
| Chemat | 500g | 1852.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 124184-67-4) is a chemical compound with the molecular formula C10H17NO6 and a molecular weight of 247.24 g/mol. IUPAC name: (2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: WFPSMPYVXFVVFA-ZCFIWIBFSA-N.
| Molecular formula | C10H17NO6 |
|---|---|
| Molecular weight | 247.24 g/mol |
| IUPAC name | (2R)-4-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | WFPSMPYVXFVVFA-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)