cas: 205445-51-8 — see every product listed under this CAS number, including other names
Boc-D-Phe(3,4-DiF)-OH, 98.04% (CAS 205445-51-8) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W013824-5 g |
| cas | 205445-51-8 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 352.20 Pln | |
| MedChemExpress | 10 g | 579.76 Pln | |
| MedChemExpress | 100 g | 4276.38 Pln | |
| MedChemExpress | 25 g | 1267.07 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.04% |
(2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 205445-51-8) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CYAOPVHXASZUDE-LLVKDONJSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CYAOPVHXASZUDE-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)