cas: 205445-51-8 — see every product listed under this CAS number, including other names
Boc-d-3,4-Difluorophenylalanine, 98% (CAS 205445-51-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008075-100G |
| cas | 205445-51-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 3673.72 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 955.93 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98% |
(2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 205445-51-8) is a chemical compound with the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. IUPAC name: (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CYAOPVHXASZUDE-LLVKDONJSA-N.
| Molecular formula | C14H17F2NO4 |
|---|---|
| Molecular weight | 301.29 g/mol |
| IUPAC name | (2R)-3-(3,4-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CYAOPVHXASZUDE-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)