Products 1196533-13-7
CAS 1196533-13-7 appears in our catalog under these names: Dimethachlor metabolite CGA 373464, 2-(Sulfoacetamido)dimethachlor Acetic Acid, 2-(Sulfoacetamido) dimoxystrobin acetic acid, Dimethachlor Metabolite CGA 373464, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, TRC, Biosynth, HPC Standards. Available pack sizes: 10mg, 100mg, 25mg, 1x1ml.
2-(2,6-dimethyl-N-(2-sulfoacetyl)anilino)acetic acid (CAS 1196533-13-7) is a chemical compound with the molecular formula C12H15NO6S and a molecular weight of 301.32 g/mol. IUPAC name: 2-(2,6-dimethyl-N-(2-sulfoacetyl)anilino)acetic acid. InChIKey: JOYZWOZQQXZLFT-UHFFFAOYSA-N.
| Molecular formula | C12H15NO6S |
|---|---|
| Molecular weight | 301.32 g/mol |
| IUPAC name | 2-(2,6-dimethyl-N-(2-sulfoacetyl)anilino)acetic acid |
| InChIKey | JOYZWOZQQXZLFT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)N(CC(=O)O)C(=O)CS(=O)(=O)O |
Computed by PubChem (NCBI)