cas: 587-84-8 — see every product listed under this CAS number, including other names
Diphenylamine Sulfate, >98.0%(HPLC)(T) (CAS 587-84-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D0875-25G |
| cas | 587-84-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 270.78 Pln | |
| TCI | 500g | 2635.98 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
N-phenylaniline;sulfuric acid (CAS 587-84-8) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: N-phenylaniline;sulfuric acid. InChIKey: IPZMDJYHJNHGML-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | N-phenylaniline;sulfuric acid |
| InChIKey | IPZMDJYHJNHGML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2.OS(=O)(=O)O |
Computed by PubChem (NCBI)