Products 893764-79-9
CAS 893764-79-9 is the registry number for 4-(Cyclopentylthio)-3-nitrobenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-cyclopentylsulfanyl-3-nitrobenzoic acid (CAS 893764-79-9) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: 4-cyclopentylsulfanyl-3-nitrobenzoic acid. InChIKey: QFRRVRJMPRJHQD-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | 4-cyclopentylsulfanyl-3-nitrobenzoic acid |
| InChIKey | QFRRVRJMPRJHQD-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)SC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(cyclopentylthio)-3-nitrobenzoic acid, 4-(cyclopentylsulfanyl)-3-nitrobenzoic acid, 4-cyclopentylsulfanyl-3-nitrobenzoic acid, benzoic acid, 4-(cyclopentylthio)-3-nitro-, 4-cyclopentylthio-3-nitrobenzoic acid, 4-(cyclopentylthio)-3-nitrobenzoicacid, 4-cyclopentylsulfanyl-3-nitro-benzoic acid