Products 587-84-8
CAS 587-84-8 appears in our catalog under these names: Diphenylamine sulfate, 98%, Diphenylamine sulfate, Diphenylamine Sulfate, >98.0%(HPLC)(T), Diphenylamine sulfate, 98%+, 98%+, Diphenylamine sulfate. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g, 500g.
N-phenylaniline;sulfuric acid (CAS 587-84-8) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: N-phenylaniline;sulfuric acid. InChIKey: IPZMDJYHJNHGML-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | N-phenylaniline;sulfuric acid |
| InChIKey | IPZMDJYHJNHGML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2.OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
DIPHENYLAMINE SULFATE, Diphenylamine, hydrogen sulfate, Diphenylammonium hydrogen sulphate, DIPHENYLAMINE SULFATE [MI], DIPHENYLAMINE, SULFATE, N-phenylaniline;sulfuric acid, N-phenylaniline; sulfuric acid, DIPHENYLAMINE HYDROGEN SULFATE, Bis(N-phenylanilinium) sulphate, Diphenylaminsulfat