CAS 2714556-60-0 is the registry number for (5-Methyloxazol-4-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(5-methyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate (CAS 2714556-60-0) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: (5-methyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate. InChIKey: GDGMUMJZGXSRQI-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | (5-methyl-1,3-oxazol-4-yl)methyl 4-methylbenzenesulfonate |
| InChIKey | GDGMUMJZGXSRQI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2=C(OC=N2)C |
Computed by PubChem (NCBI)