CAS 2852760-93-9 is the registry number for 4-Isopropyl-3-methyl-6H-thieno[2,3-b]pyrrole-2,5-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-4-propan-2-yl-6H-thieno[2,3-b]pyrrole-2,5-dicarboxylic acid (CAS 2852760-93-9) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: 3-methyl-4-propan-2-yl-6H-thieno[2,3-b]pyrrole-2,5-dicarboxylic acid. InChIKey: YTSORVODZRAGMW-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | 3-methyl-4-propan-2-yl-6H-thieno[2,3-b]pyrrole-2,5-dicarboxylic acid |
| InChIKey | YTSORVODZRAGMW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=C(N2)C(=O)O)C(C)C)C(=O)O |
Computed by PubChem (NCBI)