CAS 131436-78-7 is the registry number for Ethyl 4-hydroxy-5-oxo-1-(2-thienylmethyl)-2,5-dihydro-1h-pyrrole-3-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Ethyl 4-hydroxy-5-oxo-1-(thiophen-2-ylmethyl)-2H-pyrrole-3-carboxylate (CAS 131436-78-7) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: ethyl 4-hydroxy-5-oxo-1-(thiophen-2-ylmethyl)-2H-pyrrole-3-carboxylate. InChIKey: LCDLJTYTVMVKMU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | ethyl 4-hydroxy-5-oxo-1-(thiophen-2-ylmethyl)-2H-pyrrole-3-carboxylate |
| InChIKey | LCDLJTYTVMVKMU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=O)N(C1)CC2=CC=CS2)O |
Computed by PubChem (NCBI)