CAS 98184-58-8 appears in our catalog under these names: 2-(3-Methanesulfonylpropyl)isoindole-1,3-dione, 98%, 2-(3-(Methylsulfonyl)propyl)isoindoline-1,3-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
2-(3-methylsulfonylpropyl)isoindole-1,3-dione (CAS 98184-58-8) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: 2-(3-methylsulfonylpropyl)isoindole-1,3-dione. InChIKey: CSIJUHOYVCEFIE-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | 2-(3-methylsulfonylpropyl)isoindole-1,3-dione |
| InChIKey | CSIJUHOYVCEFIE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCCN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)