Products 907969-47-5
CAS 907969-47-5 is the registry number for 1-(2-Benzenesulfonyl-acetyl)-pyrrolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 50mg, 250mg.
1-[2-(benzenesulfonyl)acetyl]pyrrolidin-2-one (CAS 907969-47-5) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: 1-[2-(benzenesulfonyl)acetyl]pyrrolidin-2-one. InChIKey: IJGGKBMTKCJJEX-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4S |
|---|---|
| Molecular weight | 267.30 g/mol |
| IUPAC name | 1-[2-(benzenesulfonyl)acetyl]pyrrolidin-2-one |
| InChIKey | IJGGKBMTKCJJEX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C(=O)CS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)