Products 278782-54-0

CAS 278782-54-0 is the registry number for 2-((2-((4-Acetylphenyl)amino)-2-oxoethyl)thio)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[2-(4-acetylanilino)-2-oxoethyl]sulfanylacetic acid (CAS 278782-54-0) is a chemical compound with the molecular formula C12H13NO4S and a molecular weight of 267.30 g/mol. IUPAC name: 2-[2-(4-acetylanilino)-2-oxoethyl]sulfanylacetic acid. InChIKey: FJKWWSBQWWMSRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO4S
Molecular weight267.30 g/mol
IUPAC name2-[2-(4-acetylanilino)-2-oxoethyl]sulfanylacetic acid
InChIKeyFJKWWSBQWWMSRQ-UHFFFAOYSA-N
SMILESCC(=O)C1=CC=C(C=C1)NC(=O)CSCC(=O)O

Computed by PubChem (NCBI)