cas: 1999-00-4 — see every product listed under this CAS number, including other names
Ethyl (4-Fluorobenzoyl)acetate, >98.0%(GC)(T) (CAS 1999-00-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0435-1G |
| cas | 1999-00-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 147.85 Pln | |
| TCI | 5g | 467.47 Pln | |
| TCI | 25g | 1972.15 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate (CAS 1999-00-4) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)-3-oxopropanoate. InChIKey: SJUXLKYJKQBZLM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | ethyl 3-(4-fluorophenyl)-3-oxopropanoate |
| InChIKey | SJUXLKYJKQBZLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)