cas: 1999-00-4 — see every product listed under this CAS number, including other names
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate, 95%, 95% (CAS 1999-00-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CFK-1g |
| cas | 1999-00-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 232.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate (CAS 1999-00-4) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)-3-oxopropanoate. InChIKey: SJUXLKYJKQBZLM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | ethyl 3-(4-fluorophenyl)-3-oxopropanoate |
| InChIKey | SJUXLKYJKQBZLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)