cas: 1999-00-4 — see every product listed under this CAS number, including other names
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate, 97.0% (CAS 1999-00-4) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-77160-5 g |
| cas | 1999-00-4 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10 g | 287.18 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
Ethyl 3-(4-fluorophenyl)-3-oxopropanoate (CAS 1999-00-4) is a chemical compound with the molecular formula C11H11FO3 and a molecular weight of 210.20 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)-3-oxopropanoate. InChIKey: SJUXLKYJKQBZLM-UHFFFAOYSA-N.
| Molecular formula | C11H11FO3 |
|---|---|
| Molecular weight | 210.20 g/mol |
| IUPAC name | ethyl 3-(4-fluorophenyl)-3-oxopropanoate |
| InChIKey | SJUXLKYJKQBZLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)