cas: 1309933-04-7 — see every product listed under this CAS number, including other names
Ethyl 3-bromo-2,6-difluorobenzoate, 98% (CAS 1309933-04-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F098388-500MG |
| cas | 1309933-04-7 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 690.40 Pln | |
| Fluorochem | 1g | 950.72 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 3-bromo-2,6-difluorobenzoate (CAS 1309933-04-7) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 3-bromo-2,6-difluorobenzoate. InChIKey: LKIQAXWEIBVROY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 3-bromo-2,6-difluorobenzoate |
| InChIKey | LKIQAXWEIBVROY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)Br)F |
Computed by PubChem (NCBI)