cas: 1504876-00-9 — see every product listed under this CAS number, including other names
Ethyl 3-bromo-2,5-difluorobenzoate, 97%, 97% (CAS 1504876-00-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112MNA-100mg |
| cas | 1504876-00-9 |
| size | 100mg |
| availability | 9.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 395.60 Pln | |
| Chemat | 1g | 1110.80 Pln | |
| Chemat | 5g | 3054.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-bromo-2,5-difluorobenzoate (CAS 1504876-00-9) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 3-bromo-2,5-difluorobenzoate. InChIKey: LNANLRIATMKUKI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 3-bromo-2,5-difluorobenzoate |
| InChIKey | LNANLRIATMKUKI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)F)Br)F |
Computed by PubChem (NCBI)