cas: 73987-37-8 — see every product listed under this CAS number, including other names
Ethyl 8-chloro-4-hydroxyquinoline-3-carboxylate, 97%, 97% (CAS 73987-37-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QE2-1g |
| cas | 73987-37-8 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 8-chloro-4-oxo-1H-quinoline-3-carboxylate (CAS 73987-37-8) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: ethyl 8-chloro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: CVTZGJPEFPRNNB-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | ethyl 8-chloro-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | CVTZGJPEFPRNNB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC=C2Cl |
Computed by PubChem (NCBI)