CAS 523-66-0 appears in our catalog under these names: Evolitrine/ 99.03% (existing batch purity), Evolitrine, Evolitrine 98%, 4,7-Dimethoxyfuro[2,3-b]quinoline, 98%, 98%, Evolitrine, 99.95%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg.
4,7-dimethoxyfuro[2,3-b]quinoline (CAS 523-66-0) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 4,7-dimethoxyfuro[2,3-b]quinoline. InChIKey: TWGHMXOYRUTQOL-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 4,7-dimethoxyfuro[2,3-b]quinoline |
| InChIKey | TWGHMXOYRUTQOL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=C3C=COC3=N2)OC |
Computed by PubChem (NCBI)