cas: 1076197-00-6 — see every product listed under this CAS number, including other names
FMOC-3-AMINO-2,2-DIMETHYL-PROPIONIC ACID, 97%, 97% (CAS 1076197-00-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HB1S-100mg |
| cas | 1076197-00-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 496.40 Pln | |
| Chemat | 250mg | 755.60 Pln | |
| Chemat | 1g | 1451.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-dimethylpropanoic acid (CAS 1076197-00-6) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-dimethylpropanoic acid. InChIKey: YQSADVVFFDZPHI-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-dimethylpropanoic acid |
| InChIKey | YQSADVVFFDZPHI-UHFFFAOYSA-N |
| SMILES | CC(C)(CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)