cas: 1076197-00-6 — see every product listed under this CAS number, including other names
Fmoc-3-amino-2,2-dimethyl-propionic acid 97% (CAS 1076197-00-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A344069-100mg |
| cas | 1076197-00-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 726.38 Pln | |
| Ambeed | 1g | 1327.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A344069 |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-dimethylpropanoic acid (CAS 1076197-00-6) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-dimethylpropanoic acid. InChIKey: YQSADVVFFDZPHI-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2,2-dimethylpropanoic acid |
| InChIKey | YQSADVVFFDZPHI-UHFFFAOYSA-N |
| SMILES | CC(C)(CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)