cas: 170642-28-1 — see every product listed under this CAS number, including other names
FMOC-D-ALLYLGLYCINE, 95%, 95% (CAS 170642-28-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1189J2-250mg |
| cas | 170642-28-1 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 25g | 1331.60 Pln | |
| Chemat | 100g | 4125.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 170642-28-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-GOSISDBHSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-GOSISDBHSA-N |
| SMILES | C=CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)