cas: 244031-65-0 — see every product listed under this CAS number, including other names
Fmoc-β-DL-Val-OH 97% (CAS 244031-65-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A672029-100mg |
| cas | 244031-65-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1215.88 Pln | |
| Ambeed | 5g | 3930.38 Pln | |
| Ambeed | 10g | 6249.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A672029 |
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid (CAS 244031-65-0) is a chemical compound with the molecular formula C20H21NO4 and a molecular weight of 339.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid. InChIKey: PLCQKKONXZEZCF-UHFFFAOYSA-N.
| Molecular formula | C20H21NO4 |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoic acid |
| InChIKey | PLCQKKONXZEZCF-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)