cas: 88574-06-5 — see every product listed under this CAS number, including other names
Fmoc-ε-Acp-OH, 99.90% (CAS 88574-06-5) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 5 g, 10 g, 500 g, 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008689-50 g |
| cas | 88574-06-5 |
| size | 50 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 551.89 Pln | |
| MedChemExpress | 5 g | 240.74 Pln | |
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 500 g | 1703.60 Pln | |
| MedChemExpress | 25 g | 407.93 Pln | |
| MedChemExpress | 100 g | 816.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.90% |
6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 88574-06-5) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: FPCPONSZWYDXRD-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | FPCPONSZWYDXRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCC(=O)O |
Computed by PubChem (NCBI)