Fmoc-6-Ahx-OH, 97.00%
cas: 88574-06-5 — see every product listed under this CAS number, including other names
Fmoc-6-Ahx-OH, 97.00% (CAS 88574-06-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM02420M-10g |
| cas | 88574-06-5 |
| size | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 850.22 Pln | |
| Chemat | 1g | 179.35 Pln | |
| Chemat | 5g | 507.07 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.00% |
| category | Chemicals |
6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 88574-06-5) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: FPCPONSZWYDXRD-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | FPCPONSZWYDXRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
6-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanoic acid, 6-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid, 6-{{[(9H-Fluoren-9-yl)methoxy]carbonyl}amino}hexanoic Acid, Fmoc-epsilon-Acp-OH, Fmoc-6-Ahx-OH, Fmoc-|A-Acp-OH, N-Fmoc-6-aminohexanoic acid, Fmoc-?-Acp-OH, 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic Acid, 6-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid