cas: 88574-06-5 — see every product listed under this CAS number, including other names
Fmoc-6-aminohexanoic acid, 98%, 98% (CAS 88574-06-5) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QMP-1kg |
| cas | 88574-06-5 |
| size | 1kg |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 2013.20 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 261.20 Pln | |
| Chemat | 500g | 1132.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 88574-06-5) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: FPCPONSZWYDXRD-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | FPCPONSZWYDXRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCC(=O)O |
Computed by PubChem (NCBI)