cas: 146549-21-5 — see every product listed under this CAS number, including other names
Fmoc-Gly(allyl)-OH 97% (CAS 146549-21-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A130423-1g |
| cas | 146549-21-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 10g | 581.75 Pln | |
| Ambeed | 25g | 1349.38 Pln | |
| Ambeed | 100g | 5176.38 Pln | |
| Ambeed | 500g | 20495.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A130423 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (CAS 146549-21-5) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid. InChIKey: YVBLQCANYSFEBN-SFHVURJKSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| InChIKey | YVBLQCANYSFEBN-SFHVURJKSA-N |
| SMILES | C=CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)