CAS 1301706-48-8 is the registry number for (3S,4R)-3-Amino-4-methylhexanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-3-amino-4-methylhexanoic acid;hydrochloride (CAS 1301706-48-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (3S,4R)-3-amino-4-methylhexanoic acid;hydrochloride. InChIKey: RWKVKXFASXUCRV-IBTYICNHSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (3S,4R)-3-amino-4-methylhexanoic acid;hydrochloride |
| InChIKey | RWKVKXFASXUCRV-IBTYICNHSA-N |
| SMILES | CC[C@@H](C)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)