Products 1301706-48-8

CAS 1301706-48-8 is the registry number for (3S,4R)-3-Amino-4-methylhexanoic acid hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3S,4R)-3-amino-4-methylhexanoic acid;hydrochloride (CAS 1301706-48-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (3S,4R)-3-amino-4-methylhexanoic acid;hydrochloride. InChIKey: RWKVKXFASXUCRV-IBTYICNHSA-N.

Identity
Molecular formulaC7H16ClNO2
Molecular weight181.66 g/mol
IUPAC name(3S,4R)-3-amino-4-methylhexanoic acid;hydrochloride
InChIKeyRWKVKXFASXUCRV-IBTYICNHSA-N
SMILESCC[C@@H](C)[C@H](CC(=O)O)N.Cl

Computed by PubChem (NCBI)