cas: 138165-77-2 — see every product listed under this CAS number, including other names
H-β-HoPhe-OH.HCl, 99.65% (CAS 138165-77-2) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 250 mg, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W012451-10 g |
| cas | 138165-77-2 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 1020.94 Pln | |
| MedChemExpress | 25 g | 2376.98 Pln | |
| MedChemExpress | 250 mg | 240.74 Pln | |
| MedChemExpress | 1 g | 315.05 Pln | |
| MedChemExpress | 5 g | 863.04 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.65% |
(3S)-3-amino-4-phenylbutanoic acid;hydrochloride (CAS 138165-77-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (3S)-3-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: MQTMGKGSJOPWJW-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (3S)-3-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | MQTMGKGSJOPWJW-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)