cas: 138165-77-2 — see every product listed under this CAS number, including other names
(S)-3-Amino-4-phenylbutyric acid hydrochloride, 95% (CAS 138165-77-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078569-250MG |
| cas | 138165-77-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 10g | 1044.44 Pln | |
| Fluorochem | 25g | 2533.50 Pln | |
| Fluorochem | 100g | 6480.03 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3S)-3-amino-4-phenylbutanoic acid;hydrochloride (CAS 138165-77-2) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (3S)-3-amino-4-phenylbutanoic acid;hydrochloride. InChIKey: MQTMGKGSJOPWJW-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (3S)-3-amino-4-phenylbutanoic acid;hydrochloride |
| InChIKey | MQTMGKGSJOPWJW-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)