H-D-Glu(OtBu)-OH 97%
cas: 45125-00-6 — see every product listed under this CAS number, including other names
H-D-Glu(OtBu)-OH 97% (CAS 45125-00-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164413-1g |
| cas | 45125-00-6 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 431.56 Pln | |
| Ambeed | 100g | 1227.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A164413 |
(2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CAS 45125-00-6) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid. InChIKey: OIOAKXPMBIZAHL-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| InChIKey | OIOAKXPMBIZAHL-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
H-D-Glu(OtBu)-OH, (R)-2-Amino-5-(tert-butoxy)-5-oxopentanoic acid, D-Glutamic acid 5-tert-butyl ester, (2R)-2-amino-5-(tert-butoxy)-5-oxopentanoic acid, (2R)-2-amino-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid, (2R)-2-azaniumyl-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoate, D-Glutamic acid gamma-tert-butyl ester, D-Glutamic acid, 5-(1,1-dimethylethyl) ester, Linaclotide Impurity 20, (R)-2-Amino-5-(tert-butoxy)-5-oxopentanoicacid