cas: 104944-18-5 — see every product listed under this CAS number, including other names
H-D-Val-OtBu.HCl, 98.0% (CAS 104944-18-5) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W014418-25 g |
| cas | 104944-18-5 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 277.90 Pln | |
| MedChemExpress | 100 g | 719.08 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
Tert-butyl (2R)-2-amino-3-methylbutanoate;hydrochloride (CAS 104944-18-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-methylbutanoate;hydrochloride. InChIKey: AUIVQIHTTVPKFS-OGFXRTJISA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-methylbutanoate;hydrochloride |
| InChIKey | AUIVQIHTTVPKFS-OGFXRTJISA-N |
| SMILES | CC(C)[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)