cas: 104944-18-5 — see every product listed under this CAS number, including other names
H-D-Val-OtBu.HCl, 95% (CAS 104944-18-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06080-10G |
| cas | 104944-18-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 174.96 Pln | |
| Fluorochem | 100g | 529.00 Pln | |
| Fluorochem | 500g | 2413.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (2R)-2-amino-3-methylbutanoate;hydrochloride (CAS 104944-18-5) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: tert-butyl (2R)-2-amino-3-methylbutanoate;hydrochloride. InChIKey: AUIVQIHTTVPKFS-OGFXRTJISA-N.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | tert-butyl (2R)-2-amino-3-methylbutanoate;hydrochloride |
| InChIKey | AUIVQIHTTVPKFS-OGFXRTJISA-N |
| SMILES | CC(C)[C@H](C(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)