cas: 176896-72-3 — see every product listed under this CAS number, including other names
H-P-FLUORO-D-PHE-OME HCL, 97%, 97% (CAS 176896-72-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1135Y4-25g |
| cas | 176896-72-3 |
| size | 25g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 7984.40 Pln | |
| Chemat | 100g | 23810.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride (CAS 176896-72-3) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: FHEHCZJLZDLUAW-SBSPUUFOSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | FHEHCZJLZDLUAW-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)