Products 64231-55-6
CAS 64231-55-6 appears in our catalog under these names: 4-Fluoro-L-phenylalanine methyl ester hydrochloride, 98%, 4–Fluoro–L–phenylalanine methyl ester, HCl, L-Phenylalanine, 4-fluoro-, methyl ester, hydrochloride (1:1), 95%, 95%, 4-Fluoro-L-phenylalanine methyl ester hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
Methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride (CAS 64231-55-6) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride. InChIKey: FHEHCZJLZDLUAW-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-fluorophenyl)propanoate;hydrochloride |
| InChIKey | FHEHCZJLZDLUAW-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)