cas: 106402-41-9 — see every product listed under this CAS number, including other names
H-Ser-OtBu·HCl 97% (CAS 106402-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A155621-100mg |
| cas | 106402-41-9 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 10g | 854.31 Pln | |
| Ambeed | 25g | 2028.00 Pln | |
| Ambeed | 100g | 7295.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A155621 |
Tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride (CAS 106402-41-9) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride. InChIKey: TUDHOGYHZNNYHW-JEDNCBNOSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride |
| InChIKey | TUDHOGYHZNNYHW-JEDNCBNOSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)