Products 1417997-93-3
CAS 1417997-93-3 appears in our catalog under these names: HDAC8-IN-1/ 99.83% (existing batch purity), HDAC8–IN–1, HDAC8-IN-1, HDAC8-IN-1 99%, (E)-N-hydroxy-3-(5-methoxy-[1,1':4',1''-terphenyl]-2-yl)acrylamide, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
(E)-N-hydroxy-3-[4-methoxy-2-(4-phenylphenyl)phenyl]prop-2-enamide (CAS 1417997-93-3) is a chemical compound with the molecular formula C22H19NO3 and a molecular weight of 345.4 g/mol. IUPAC name: (E)-N-hydroxy-3-[4-methoxy-2-(4-phenylphenyl)phenyl]prop-2-enamide. InChIKey: ASHPRZYGCOMVHO-WYMLVPIESA-N.
| Molecular formula | C22H19NO3 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | (E)-N-hydroxy-3-[4-methoxy-2-(4-phenylphenyl)phenyl]prop-2-enamide |
| InChIKey | ASHPRZYGCOMVHO-WYMLVPIESA-N |
| SMILES | COC1=CC(=C(C=C1)/C=C/C(=O)NO)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)