cas: 145335-90-6 — see every product listed under this CAS number, including other names
Imidazo[1,2-a]pyridine-8-carboxylic acid hydrochloride, 98%, 98% (CAS 145335-90-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112KST-1g |
| cas | 145335-90-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 434.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Imidazo[1,2-a]pyridine-8-carboxylic acid;hydrochloride (CAS 145335-90-6) is a chemical compound with the molecular formula C8H7ClN2O2 and a molecular weight of 198.60 g/mol. IUPAC name: imidazo[1,2-a]pyridine-8-carboxylic acid;hydrochloride. InChIKey: XRQZBGADESKIBB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2 |
|---|---|
| Molecular weight | 198.60 g/mol |
| IUPAC name | imidazo[1,2-a]pyridine-8-carboxylic acid;hydrochloride |
| InChIKey | XRQZBGADESKIBB-UHFFFAOYSA-N |
| SMILES | C1=CN2C=CN=C2C(=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)