cas: 5557-83-5 — see every product listed under this CAS number, including other names
L-Alanine benzyl ester hydrochloride, 98%, 98% (CAS 5557-83-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 250g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149NI-5g |
| cas | 5557-83-5 |
| size | 5g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 500g | 513.60 Pln | |
| Chemat | 250g | 251.60 Pln | |
| Chemat | 1kg | 942.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2S)-2-aminopropanoate;hydrochloride (CAS 5557-83-5) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: benzyl (2S)-2-aminopropanoate;hydrochloride. InChIKey: RLMHWGDKMJIEHH-QRPNPIFTSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | benzyl (2S)-2-aminopropanoate;hydrochloride |
| InChIKey | RLMHWGDKMJIEHH-QRPNPIFTSA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)