cas: 886497-08-1 — see every product listed under this CAS number, including other names
METHYL 4-AMINO-2,3-DIFLUOROBENZOATE, 97%, 97% (CAS 886497-08-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1159MA-100mg |
| cas | 886497-08-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 1034.00 Pln | |
| Chemat | 5g | 2973.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-amino-2,3-difluorobenzoate (CAS 886497-08-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 4-amino-2,3-difluorobenzoate. InChIKey: MMVSLKNBOJAPEC-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 4-amino-2,3-difluorobenzoate |
| InChIKey | MMVSLKNBOJAPEC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)N)F)F |
Computed by PubChem (NCBI)