cas: 886497-08-1 — see every product listed under this CAS number, including other names
Methyl 4-amino-2,3-difluorobenzoate (CAS 886497-08-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F021974-100MG |
| cas | 886497-08-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 830.98 Pln | |
| Fluorochem | 1g | 1684.84 Pln |
| delivery time | 2-3 weeks |
|---|
Methyl 4-amino-2,3-difluorobenzoate (CAS 886497-08-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 4-amino-2,3-difluorobenzoate. InChIKey: MMVSLKNBOJAPEC-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 4-amino-2,3-difluorobenzoate |
| InChIKey | MMVSLKNBOJAPEC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)N)F)F |
Computed by PubChem (NCBI)